C22H33ClFN5O — CID 111569003
1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine (PubChem CID 111569003) has the molecular formula C22H33ClFN5O and a molecular weight of 437.99 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111569003 |
| Molecular Formula | C22H33ClFN5O |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCC(C)(C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H33ClFN5O/c1-7-25-21(26-13-18-15(2)28-29(16(18)3)10-11-30-6)27-14-22(4,5)19-9-8-17(24)12-20(19)23/h8-9,12H,7,10-11,13-14H2,1-6H3,(H2,25,26,27) |
| InChIKey | OVXDKNUOGBBAKY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|