C20H39N5O2 — CID 111716828
1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine (PubChem CID 111716828) has the molecular formula C20H39N5O2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111716828 |
| Molecular Formula | C20H39N5O2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCC(CC)(CC)CCO |
| InChI | InChI=1S/C20H39N5O2/c1-7-20(8-2,10-12-26)15-23-19(21-9-3)22-14-18-16(4)24-25(17(18)5)11-13-27-6/h26H,7-15H2,1-6H3,(H2,21,22,23) |
| InChIKey | CLDUZZURWLFQCW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|