C20H28ClN5 — CID 111952109
1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111952109) has the molecular formula C20H28ClN5 and a molecular weight of 373.93 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111952109 |
| Molecular Formula | C20H28ClN5 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclobutyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1c(C)nn(C)c1C)NCC1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C20H28ClN5/c1-14-18(15(2)26(4)25-14)12-23-19(22-3)24-13-20(10-5-11-20)16-6-8-17(21)9-7-16/h6-9H,5,10-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | PCUKLIVFEUVWPG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|