C16H17BrF3N3O — CID 109471175
1-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471175) has the molecular formula C16H17BrF3N3O and a molecular weight of 404.23 g/mol. Its IUPAC name is 1-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471175 |
| Molecular Formula | C16H17BrF3N3O |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 1-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C16H17BrF3N3O/c1-21-15(22-9-8-16(18,19)20)23-10-13-6-7-14(24-13)11-2-4-12(17)5-3-11/h2-7H,8-10H2,1H3,(H2,21,22,23) |
| InChIKey | HMTDOMVKJOAJKS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|