C13H18N4O2S — CID 111458011
1-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(thiophen-3-ylmethyl)urea (PubChem CID 111458011) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 111458011 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(thiophen-3-ylmethyl)urea |
| SMILES | Cn1cc(C(C)(O)CNC(=O)NCc2ccsc2)cn1 |
| InChI | InChI=1S/C13H18N4O2S/c1-13(19,11-6-16-17(2)7-11)9-15-12(18)14-5-10-3-4-20-8-10/h3-4,6-8,19H,5,9H2,1-2H3,(H2,14,15,18) |
| InChIKey | SNJHQCXGCNFXAA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |