C12H21ClN2OS — CID 119641880
N-(2-amino-2-ethylbutyl)-2-thiophen-3-ylacetamide;hydrochloride (PubChem CID 119641880) has the molecular formula C12H21ClN2OS and a molecular weight of 276.83 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-thiophen-3-ylacetamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-thiophen-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119641880 |
| Molecular Formula | C12H21ClN2OS |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-thiophen-3-ylacetamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)Cc1ccsc1.Cl |
| InChI | InChI=1S/C12H20N2OS.ClH/c1-3-12(13,4-2)9-14-11(15)7-10-5-6-16-8-10;/h5-6,8H,3-4,7,9,13H2,1-2H3,(H,14,15);1H |
| InChIKey | PYUGEBFMPWEVGB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |