C13H20ClNOS — CID 107156940
N-(2-chloro-4,4-dimethylpentyl)-2-thiophen-3-ylacetamide (PubChem CID 107156940) has the molecular formula C13H20ClNOS and a molecular weight of 273.83 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 107156940 |
| Molecular Formula | C13H20ClNOS |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-2-thiophen-3-ylacetamide |
| SMILES | CC(C)(C)CC(Cl)CNC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C13H20ClNOS/c1-13(2,3)7-11(14)8-15-12(16)6-10-4-5-17-9-10/h4-5,9,11H,6-8H2,1-3H3,(H,15,16) |
| InChIKey | BQKGFIKXJGWUNS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|