C16H15NO2S3 — CID 164635798
N-[(2S)-2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-2-thiophen-3-ylacetamide (PubChem CID 164635798) has the molecular formula C16H15NO2S3 and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[(2S)-2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 164635798 |
| Molecular Formula | C16H15NO2S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)NC[C@H](O)c1ccc(-c2ccsc2)s1 |
| InChI | InChI=1S/C16H15NO2S3/c18-13(8-17-16(19)7-11-3-5-20-9-11)15-2-1-14(22-15)12-4-6-21-10-12/h1-6,9-10,13,18H,7-8H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | PFOSSNWUPWCUFY-ZDUSSCGKSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |