C24H19NO3S2 — CID 131702724
N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-9H-xanthene-9-carboxamide (PubChem CID 131702724) has the molecular formula C24H19NO3S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 131702724 |
| Molecular Formula | C24H19NO3S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(-c2ccsc2)s1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C24H19NO3S2/c26-18(22-10-9-21(30-22)15-11-12-29-14-15)13-25-24(27)23-16-5-1-3-7-19(16)28-20-8-4-2-6-17(20)23/h1-12,14,18,23,26H,13H2,(H,25,27) |
| InChIKey | AFSBBFJQDOZFSL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |