C19H18BrNO2S2 — CID 126854849
3-(2-bromophenyl)-N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]propanamide (PubChem CID 126854849) has the molecular formula C19H18BrNO2S2 and a molecular weight of 436.40 g/mol. Its IUPAC name is 3-(2-bromophenyl)-N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]propanamide.
| Compound Name | 3-(2-bromophenyl)-N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 126854849 |
| Molecular Formula | C19H18BrNO2S2 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 3-(2-bromophenyl)-N-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]propanamide |
| SMILES | O=C(CCc1ccccc1Br)NCC(O)c1ccc(-c2ccsc2)s1 |
| InChI | InChI=1S/C19H18BrNO2S2/c20-15-4-2-1-3-13(15)5-8-19(23)21-11-16(22)18-7-6-17(25-18)14-9-10-24-12-14/h1-4,6-7,9-10,12,16,22H,5,8,11H2,(H,21,23) |
| InChIKey | ITCWRFWEZIFKJW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |