C17H16N2O3S3 — CID 131702053
N'-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 131702053) has the molecular formula C17H16N2O3S3 and a molecular weight of 392.53 g/mol. Its IUPAC name is N'-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 131702053 |
| Molecular Formula | C17H16N2O3S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N'-[2-hydroxy-2-(5-thiophen-3-ylthiophen-2-yl)ethyl]-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccs1)C(=O)NCC(O)c1ccc(-c2ccsc2)s1 |
| InChI | InChI=1S/C17H16N2O3S3/c20-13(15-4-3-14(25-15)11-5-7-23-10-11)9-19-17(22)16(21)18-8-12-2-1-6-24-12/h1-7,10,13,20H,8-9H2,(H,18,21)(H,19,22) |
| InChIKey | FMXWHCDSZIDUTO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|