C16H26OS — CID 163531190
(4S)-2,2,6,6-tetramethyl-4-(thiophen-3-ylmethyl)heptan-3-one (PubChem CID 163531190) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is (4S)-2,2,6,6-tetramethyl-4-(thiophen-3-ylmethyl)heptan-3-one.
| Compound Name | (4S)-2,2,6,6-tetramethyl-4-(thiophen-3-ylmethyl)heptan-3-one |
|---|---|
| PubChem CID | 163531190 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (4S)-2,2,6,6-tetramethyl-4-(thiophen-3-ylmethyl)heptan-3-one |
| SMILES | CC(C)(C)C[C@@H](Cc1ccsc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H26OS/c1-15(2,3)10-13(14(17)16(4,5)6)9-12-7-8-18-11-12/h7-8,11,13H,9-10H2,1-6H3/t13-/m1/s1 |
| InChIKey | OLIPYTNPRUTCAA-CYBMUJFWSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |