C11H15NOS — CID 115628042
N-[(E)-pent-3-enyl]-2-thiophen-3-ylacetamide (PubChem CID 115628042) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[(E)-pent-3-enyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 115628042 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-[(E)-pent-3-enyl]-2-thiophen-3-ylacetamide |
| SMILES | C/C=C/CCNC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C11H15NOS/c1-2-3-4-6-12-11(13)8-10-5-7-14-9-10/h2-3,5,7,9H,4,6,8H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | NSXUHJBPWABUOD-NSCUHMNNSA-N |
| XLogP | 2.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|