C12H18BrNOS — CID 106158024
N-(5-bromo-4-methylpentyl)-2-thiophen-3-ylacetamide (PubChem CID 106158024) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(5-bromo-4-methylpentyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 106158024 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)-2-thiophen-3-ylacetamide |
| SMILES | CC(CBr)CCCNC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C12H18BrNOS/c1-10(8-13)3-2-5-14-12(15)7-11-4-6-16-9-11/h4,6,9-10H,2-3,5,7-8H2,1H3,(H,14,15) |
| InChIKey | CFFKCMAQQBEKMB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|