C9H14NO3S+ — CID 102299625
[(1R)-1-carboxy-2-(2-thiophen-3-ylethoxy)ethyl]azanium (PubChem CID 102299625) has the molecular formula C9H14NO3S+ and a molecular weight of 216.28 g/mol. Its IUPAC name is [(1R)-1-carboxy-2-(2-thiophen-3-ylethoxy)ethyl]azanium.
| Compound Name | [(1R)-1-carboxy-2-(2-thiophen-3-ylethoxy)ethyl]azanium |
|---|---|
| PubChem CID | 102299625 |
| Molecular Formula | C9H14NO3S+ |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | [(1R)-1-carboxy-2-(2-thiophen-3-ylethoxy)ethyl]azanium |
| SMILES | [NH3+][C@H](COCCc1ccsc1)C(=O)O |
| InChI | InChI=1S/C9H13NO3S/c10-8(9(11)12)5-13-3-1-7-2-4-14-6-7/h2,4,6,8H,1,3,5,10H2,(H,11,12)/p+1/t8-/m1/s1 |
| InChIKey | QDILSUGGYHUTQN-MRVPVSSYSA-O |
| XLogP | 0.00 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|