C11H14F2O2S — CID 103147032
1-(2,2-difluoroethoxy)-5-thiophen-3-ylpentan-3-one (PubChem CID 103147032) has the molecular formula C11H14F2O2S and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-5-thiophen-3-ylpentan-3-one.
| Compound Name | 1-(2,2-difluoroethoxy)-5-thiophen-3-ylpentan-3-one |
|---|---|
| PubChem CID | 103147032 |
| Molecular Formula | C11H14F2O2S |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-5-thiophen-3-ylpentan-3-one |
| SMILES | O=C(CCOCC(F)F)CCc1ccsc1 |
| InChI | InChI=1S/C11H14F2O2S/c12-11(13)7-15-5-3-10(14)2-1-9-4-6-16-8-9/h4,6,8,11H,1-3,5,7H2 |
| InChIKey | FRFFWNREASQLJR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|