C21H22OS — CID 101402124
3-[2-(3,3-diphenylpropoxy)ethyl]thiophene (PubChem CID 101402124) has the molecular formula C21H22OS and a molecular weight of 322.47 g/mol. Its IUPAC name is 3-[2-(3,3-diphenylpropoxy)ethyl]thiophene.
| Compound Name | 3-[2-(3,3-diphenylpropoxy)ethyl]thiophene |
|---|---|
| PubChem CID | 101402124 |
| Molecular Formula | C21H22OS |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[2-(3,3-diphenylpropoxy)ethyl]thiophene |
| SMILES | c1ccc(C(CCOCCc2ccsc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22OS/c1-3-7-19(8-4-1)21(20-9-5-2-6-10-20)12-15-22-14-11-18-13-16-23-17-18/h1-10,13,16-17,21H,11-12,14-15H2 |
| InChIKey | MSTLDIIOAIXQDP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|