About (2-ethenylphenyl)methyl thiophene-3-carboxylate
(2-ethenylphenyl)methyl thiophene-3-carboxylate (PubChem CID 172538879) has the molecular formula C14H12O2S
and a molecular weight of 244.31 g/mol. Its IUPAC name is (2-ethenylphenyl)methyl thiophene-3-carboxylate.
Molecular Properties
| Compound Name | (2-ethenylphenyl)methyl thiophene-3-carboxylate |
| PubChem CID | 172538879 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (2-ethenylphenyl)methyl thiophene-3-carboxylate |
| SMILES | C=Cc1ccccc1COC(=O)c1ccsc1 |
| InChI | InChI=1S/C14H12O2S/c1-2-11-5-3-4-6-12(11)9-16-14(15)13-7-8-17-10-13/h2-8,10H,1,9H2 |
| InChIKey | GODCIHBEVHHOJT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethenylphenyl)methyl thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethenylphenyl)methyl thiophene-3-carboxylate?
The IUPAC name of (2-ethenylphenyl)methyl thiophene-3-carboxylate (CID 172538879) is (2-ethenylphenyl)methyl thiophene-3-carboxylate.
What is the SMILES notation for (2-ethenylphenyl)methyl thiophene-3-carboxylate?
The canonical SMILES for (2-ethenylphenyl)methyl thiophene-3-carboxylate is C=Cc1ccccc1COC(=O)c1ccsc1.
What is the InChIKey of (2-ethenylphenyl)methyl thiophene-3-carboxylate?
The InChIKey is GODCIHBEVHHOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S/c1-2-11-5-3-4-6-12(11)9-16-14(15)13-7-8-17-10-13/h2-8,10H,1,9H2.
What are the key properties of (2-ethenylphenyl)methyl thiophene-3-carboxylate?
(2-ethenylphenyl)methyl thiophene-3-carboxylate has a molecular weight of 244.31 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethenylphenyl)methyl thiophene-3-carboxylate is sourced from PubChem (CID 172538879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).