C22H27FO2 — CID 146006669
1-[3-[(3-fluorophenyl)methoxy]phenyl]-3,5,5-trimethylhexan-1-one (PubChem CID 146006669) has the molecular formula C22H27FO2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-[3-[(3-fluorophenyl)methoxy]phenyl]-3,5,5-trimethylhexan-1-one.
| Compound Name | 1-[3-[(3-fluorophenyl)methoxy]phenyl]-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 146006669 |
| Molecular Formula | C22H27FO2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1-[3-[(3-fluorophenyl)methoxy]phenyl]-3,5,5-trimethylhexan-1-one |
| SMILES | CC(CC(=O)c1cccc(OCc2cccc(F)c2)c1)CC(C)(C)C |
| InChI | InChI=1S/C22H27FO2/c1-16(14-22(2,3)4)11-21(24)18-8-6-10-20(13-18)25-15-17-7-5-9-19(23)12-17/h5-10,12-13,16H,11,14-15H2,1-4H3 |
| InChIKey | BDUSAUAQNFOBAL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |