C15H17NO4 — CID 103162397
6-[2-(3-ethoxycyclobutyl)acetyl]-3H-1,3-benzoxazol-2-one (PubChem CID 103162397) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 6-[2-(3-ethoxycyclobutyl)acetyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(3-ethoxycyclobutyl)acetyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 103162397 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6-[2-(3-ethoxycyclobutyl)acetyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CCOC1CC(CC(=O)c2ccc3[nH]c(=O)oc3c2)C1 |
| InChI | InChI=1S/C15H17NO4/c1-2-19-11-5-9(6-11)7-13(17)10-3-4-12-14(8-10)20-15(18)16-12/h3-4,8-9,11H,2,5-7H2,1H3,(H,16,18) |
| InChIKey | CQUIODKKHUGZIT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |