C10H9NO5 — CID 116862950
2-hydroxyethyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate (PubChem CID 116862950) has the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. Its IUPAC name is 2-hydroxyethyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate.
| Compound Name | 2-hydroxyethyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 116862950 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-hydroxyethyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate |
| SMILES | O=C(OCCO)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H9NO5/c12-3-4-15-9(13)6-1-2-7-8(5-6)16-10(14)11-7/h1-2,5,12H,3-4H2,(H,11,14) |
| InChIKey | XFPCXBAHNMLQHS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |