C12H12N2O6 — CID 175287249
2-[2-oxo-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethoxy]ethylcarbamic acid (PubChem CID 175287249) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-[2-oxo-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-oxo-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 175287249 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[2-oxo-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCC(=O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H12N2O6/c15-9(6-19-4-3-13-11(16)17)7-1-2-8-10(5-7)20-12(18)14-8/h1-2,5,13H,3-4,6H2,(H,14,18)(H,16,17) |
| InChIKey | XRAWKOBHQFUPIB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|