C9H5Br2NO3 — CID 116827127
6-(2,2-dibromoacetyl)-3H-1,3-benzoxazol-2-one (PubChem CID 116827127) has the molecular formula C9H5Br2NO3 and a molecular weight of 334.95 g/mol. Its IUPAC name is 6-(2,2-dibromoacetyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(2,2-dibromoacetyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116827127 |
| Molecular Formula | C9H5Br2NO3 |
| Molecular Weight | 334.95 g/mol |
| Exact Mass | 332.86 |
| IUPAC Name | 6-(2,2-dibromoacetyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc2[nH]c(=O)oc2c1)C(Br)Br |
| InChI | InChI=1S/C9H5Br2NO3/c10-8(11)7(13)4-1-2-5-6(3-4)15-9(14)12-5/h1-3,8H,(H,12,14) |
| InChIKey | SFCOZHXEUNJIAH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.95 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|