C17H25NO2 — CID 43160152
N-[4-(3,5,5-trimethylhexanoyl)phenyl]acetamide (PubChem CID 43160152) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[4-(3,5,5-trimethylhexanoyl)phenyl]acetamide.
| Compound Name | N-[4-(3,5,5-trimethylhexanoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43160152 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[4-(3,5,5-trimethylhexanoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)CC(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO2/c1-12(11-17(3,4)5)10-16(20)14-6-8-15(9-7-14)18-13(2)19/h6-9,12H,10-11H2,1-5H3,(H,18,19) |
| InChIKey | JDLBNYIBAVWEHM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |