4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid

C14H17NO4 — CID 65298256

IUPAC4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid
SMILESCC(=O)Nc1ccc(C(=O)CC(C)(C)C(=O)O)cc1
InChIInChI=1S/C14H17NO4/c1-9(16)15-11-6-4-10(5-7-11)12(17)8-14(2,3)13(18)19/h4-7H,8H2,1-3H3,(H,15,16)(H,18,19)
InChIKeyYUVUENBICQOMDU-UHFFFAOYSA-N
MW263.29 g/mol
LogP2.33
Rot. Bonds5

About 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid

4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 65298256) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid
PubChem CID65298256
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid
SMILESCC(=O)Nc1ccc(C(=O)CC(C)(C)C(=O)O)cc1
InChIInChI=1S/C14H17NO4/c1-9(16)15-11-6-4-10(5-7-11)12(17)8-14(2,3)13(18)19/h4-7H,8H2,1-3H3,(H,15,16)(H,18,19)
InChIKeyYUVUENBICQOMDU-UHFFFAOYSA-N
XLogP2.33
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 52.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid (CID 65298256) is 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid is CC(=O)Nc1ccc(C(=O)CC(C)(C)C(=O)O)cc1.
What is the InChIKey of 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is YUVUENBICQOMDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-9(16)15-11-6-4-10(5-7-11)12(17)8-14(2,3)13(18)19/h4-7H,8H2,1-3H3,(H,15,16)(H,18,19).
What are the key properties of 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid?
4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 263.29 g/mol, XLogP of 2.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-acetamidophenyl)-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 65298256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).