C19H18N2O6 — CID 162201246
4-[[2,2-dimethyl-4-(4-nitrophenyl)-4-oxobutanoyl]amino]benzoic acid (PubChem CID 162201246) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4-[[2,2-dimethyl-4-(4-nitrophenyl)-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 4-[[2,2-dimethyl-4-(4-nitrophenyl)-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 162201246 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-[[2,2-dimethyl-4-(4-nitrophenyl)-4-oxobutanoyl]amino]benzoic acid |
| SMILES | CC(C)(CC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H18N2O6/c1-19(2,11-16(22)12-5-9-15(10-6-12)21(26)27)18(25)20-14-7-3-13(4-8-14)17(23)24/h3-10H,11H2,1-2H3,(H,20,25)(H,23,24) |
| InChIKey | VDMARXAGMVWDNB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|