3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid

C13H18N2O3 — CID 79629806

IUPAC3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid
SMILESCC(=O)Nc1ccc(NCC(C)(C)C(=O)O)cc1
InChIInChI=1S/C13H18N2O3/c1-9(16)15-11-6-4-10(5-7-11)14-8-13(2,3)12(17)18/h4-7,14H,8H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyWTWTXLOGKJHFGR-UHFFFAOYSA-N
MW250.30 g/mol
LogP2.17
Rot. Bonds5

About 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid

3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid (PubChem CID 79629806) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid
PubChem CID79629806
Molecular FormulaC13H18N2O3
Molecular Weight250.30 g/mol
Exact Mass250.13
IUPAC Name3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid
SMILESCC(=O)Nc1ccc(NCC(C)(C)C(=O)O)cc1
InChIInChI=1S/C13H18N2O3/c1-9(16)15-11-6-4-10(5-7-11)14-8-13(2,3)12(17)18/h4-7,14H,8H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyWTWTXLOGKJHFGR-UHFFFAOYSA-N
XLogP2.17
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.30
LogP ≤ 52.17
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid (CID 79629806) is 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid is CC(=O)Nc1ccc(NCC(C)(C)C(=O)O)cc1.
What is the InChIKey of 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid?
The InChIKey is WTWTXLOGKJHFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c1-9(16)15-11-6-4-10(5-7-11)14-8-13(2,3)12(17)18/h4-7,14H,8H2,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid?
3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid has a molecular weight of 250.30 g/mol, XLogP of 2.17, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-acetamidoanilino)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79629806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).