C13H16Cl2O2 — CID 83928629
5-(3,5-dichloro-4-methoxyphenyl)-4-methylpentan-2-one (PubChem CID 83928629) has the molecular formula C13H16Cl2O2 and a molecular weight of 275.18 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-methoxyphenyl)-4-methylpentan-2-one.
| Compound Name | 5-(3,5-dichloro-4-methoxyphenyl)-4-methylpentan-2-one |
|---|---|
| PubChem CID | 83928629 |
| Molecular Formula | C13H16Cl2O2 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-(3,5-dichloro-4-methoxyphenyl)-4-methylpentan-2-one |
| SMILES | COc1c(Cl)cc(CC(C)CC(C)=O)cc1Cl |
| InChI | InChI=1S/C13H16Cl2O2/c1-8(4-9(2)16)5-10-6-11(14)13(17-3)12(15)7-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | NUBJONSXJCFECH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |