C12H14ClFO2S — CID 114847721
methyl 3-[(4-chloro-2-fluorophenyl)methylsulfanyl]butanoate (PubChem CID 114847721) has the molecular formula C12H14ClFO2S and a molecular weight of 276.76 g/mol. Its IUPAC name is methyl 3-[(4-chloro-2-fluorophenyl)methylsulfanyl]butanoate.
| Compound Name | methyl 3-[(4-chloro-2-fluorophenyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 114847721 |
| Molecular Formula | C12H14ClFO2S |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | methyl 3-[(4-chloro-2-fluorophenyl)methylsulfanyl]butanoate |
| SMILES | COC(=O)CC(C)SCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H14ClFO2S/c1-8(5-12(15)16-2)17-7-9-3-4-10(13)6-11(9)14/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | OYQWIQJBUVVWIC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |