C13H17ClFNOS — CID 99824619
N-[(2S)-butan-2-yl]-2-[(4-chloro-2-fluorophenyl)methylsulfanyl]acetamide (PubChem CID 99824619) has the molecular formula C13H17ClFNOS and a molecular weight of 289.80 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[(4-chloro-2-fluorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[(4-chloro-2-fluorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 99824619 |
| Molecular Formula | C13H17ClFNOS |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[(4-chloro-2-fluorophenyl)methylsulfanyl]acetamide |
| SMILES | CC[C@H](C)NC(=O)CSCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H17ClFNOS/c1-3-9(2)16-13(17)8-18-7-10-4-5-11(14)6-12(10)15/h4-6,9H,3,7-8H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | XYVDJISCUAJOMC-VIFPVBQESA-N |
| XLogP | 3.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |