C19H21ClFNO2S — CID 133159996
2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[1-(4-methylphenoxy)propan-2-yl]acetamide (PubChem CID 133159996) has the molecular formula C19H21ClFNO2S and a molecular weight of 381.90 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[1-(4-methylphenoxy)propan-2-yl]acetamide.
| Compound Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[1-(4-methylphenoxy)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 133159996 |
| Molecular Formula | C19H21ClFNO2S |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[1-(4-methylphenoxy)propan-2-yl]acetamide |
| SMILES | Cc1ccc(OCC(C)NC(=O)CSCc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H21ClFNO2S/c1-13-3-7-17(8-4-13)24-10-14(2)22-19(23)12-25-11-15-5-6-16(20)9-18(15)21/h3-9,14H,10-12H2,1-2H3,(H,22,23) |
| InChIKey | PEHBCYSMAANMPJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |