C12H15FN2S — CID 66229073
3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzonitrile (PubChem CID 66229073) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzonitrile.
| Compound Name | 3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 66229073 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzonitrile |
| SMILES | CC(CCN)SCc1cc(C#N)ccc1F |
| InChI | InChI=1S/C12H15FN2S/c1-9(4-5-14)16-8-11-6-10(7-15)2-3-12(11)13/h2-3,6,9H,4-5,8,14H2,1H3 |
| InChIKey | UAZBKXYKPYEZKN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |