C13H14FNO2S — CID 105354001
2-[(5-cyano-2-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 105354001) has the molecular formula C13H14FNO2S and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105354001 |
| Molecular Formula | C13H14FNO2S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(SCc1cc(C#N)ccc1F)C(=O)O |
| InChI | InChI=1S/C13H14FNO2S/c1-8(2)12(13(16)17)18-7-10-5-9(6-15)3-4-11(10)14/h3-5,8,12H,7H2,1-2H3,(H,16,17) |
| InChIKey | STZAKQACTDRFTE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |