C12H12FNO3S — CID 66116178
3-[(5-cyano-2-fluorophenyl)methylsulfinyl]butanoic acid (PubChem CID 66116178) has the molecular formula C12H12FNO3S and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[(5-cyano-2-fluorophenyl)methylsulfinyl]butanoic acid.
| Compound Name | 3-[(5-cyano-2-fluorophenyl)methylsulfinyl]butanoic acid |
|---|---|
| PubChem CID | 66116178 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-[(5-cyano-2-fluorophenyl)methylsulfinyl]butanoic acid |
| SMILES | CC(CC(=O)O)S(=O)Cc1cc(C#N)ccc1F |
| InChI | InChI=1S/C12H12FNO3S/c1-8(4-12(15)16)18(17)7-10-5-9(6-14)2-3-11(10)13/h2-3,5,8H,4,7H2,1H3,(H,15,16) |
| InChIKey | GXOWBUJUEOEJFQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |