C12H17FN2OS — CID 66230954
3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzamide (PubChem CID 66230954) has the molecular formula C12H17FN2OS and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzamide.
| Compound Name | 3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 66230954 |
| Molecular Formula | C12H17FN2OS |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-(4-aminobutan-2-ylsulfanylmethyl)-4-fluorobenzamide |
| SMILES | CC(CCN)SCc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C12H17FN2OS/c1-8(4-5-14)17-7-10-6-9(12(15)16)2-3-11(10)13/h2-3,6,8H,4-5,7,14H2,1H3,(H2,15,16) |
| InChIKey | HORPNPCZVPAROY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |