C12H11FN4O2S — CID 104709881
N-[(4-cyano-2-fluorophenyl)methyl]-2-methylpyrazole-3-sulfonamide (PubChem CID 104709881) has the molecular formula C12H11FN4O2S and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[(4-cyano-2-fluorophenyl)methyl]-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-[(4-cyano-2-fluorophenyl)methyl]-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104709881 |
| Molecular Formula | C12H11FN4O2S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-[(4-cyano-2-fluorophenyl)methyl]-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C12H11FN4O2S/c1-17-12(4-5-15-17)20(18,19)16-8-10-3-2-9(7-14)6-11(10)13/h2-6,16H,8H2,1H3 |
| InChIKey | HMWBWWKYJJHAOX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |