C16H19ClFNO4 — CID 122136775
methyl 4-[[[2-(2-chloro-4-fluorophenyl)acetyl]amino]methyl]oxane-4-carboxylate (PubChem CID 122136775) has the molecular formula C16H19ClFNO4 and a molecular weight of 343.78 g/mol. Its IUPAC name is methyl 4-[[[2-(2-chloro-4-fluorophenyl)acetyl]amino]methyl]oxane-4-carboxylate.
| Compound Name | methyl 4-[[[2-(2-chloro-4-fluorophenyl)acetyl]amino]methyl]oxane-4-carboxylate |
|---|---|
| PubChem CID | 122136775 |
| Molecular Formula | C16H19ClFNO4 |
| Molecular Weight | 343.78 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | methyl 4-[[[2-(2-chloro-4-fluorophenyl)acetyl]amino]methyl]oxane-4-carboxylate |
| SMILES | COC(=O)C1(CNC(=O)Cc2ccc(F)cc2Cl)CCOCC1 |
| InChI | InChI=1S/C16H19ClFNO4/c1-22-15(21)16(4-6-23-7-5-16)10-19-14(20)8-11-2-3-12(18)9-13(11)17/h2-3,9H,4-8,10H2,1H3,(H,19,20) |
| InChIKey | HIZCZHZRVJMZDI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.78 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |