C14H23N3O2 — CID 80548872
N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide (PubChem CID 80548872) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide.
| Compound Name | N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 80548872 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide |
| SMILES | CN(Cc1ccoc1)C(=O)C(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-14(2,17-7-5-15-6-8-17)13(18)16(3)10-12-4-9-19-11-12/h4,9,11,15H,5-8,10H2,1-3H3 |
| InChIKey | ARMQVTMTCOCWDG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |