About N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide
N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide (PubChem CID 80548872) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide.
Molecular Properties
| Compound Name | N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide |
| PubChem CID | 80548872 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide |
| SMILES | CN(Cc1ccoc1)C(=O)C(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-14(2,17-7-5-15-6-8-17)13(18)16(3)10-12-4-9-19-11-12/h4,9,11,15H,5-8,10H2,1-3H3 |
| InChIKey | ARMQVTMTCOCWDG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide?
The IUPAC name of N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide (CID 80548872) is N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide.
What is the SMILES notation for N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide?
The canonical SMILES for N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide is CN(Cc1ccoc1)C(=O)C(C)(C)N1CCNCC1.
What is the InChIKey of N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide?
The InChIKey is ARMQVTMTCOCWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-14(2,17-7-5-15-6-8-17)13(18)16(3)10-12-4-9-19-11-12/h4,9,11,15H,5-8,10H2,1-3H3.
What are the key properties of N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide?
N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide has a molecular weight of 265.36 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-3-ylmethyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide is sourced from PubChem (CID 80548872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).