C15H22FN3O — CID 80550035
N-(4-fluorophenyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide (PubChem CID 80550035) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide.
| Compound Name | N-(4-fluorophenyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 80550035 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-(4-fluorophenyl)-N,2-dimethyl-2-piperazin-1-ylpropanamide |
| SMILES | CN(C(=O)C(C)(C)N1CCNCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FN3O/c1-15(2,19-10-8-17-9-11-19)14(20)18(3)13-6-4-12(16)5-7-13/h4-7,17H,8-11H2,1-3H3 |
| InChIKey | LGIBWTSYHIJBQU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |