C12H18N2O4 — CID 47377436
ethyl 2-[[methyl-[(2-methylfuran-3-yl)methyl]carbamoyl]amino]acetate (PubChem CID 47377436) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is ethyl 2-[[methyl-[(2-methylfuran-3-yl)methyl]carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[methyl-[(2-methylfuran-3-yl)methyl]carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 47377436 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl 2-[[methyl-[(2-methylfuran-3-yl)methyl]carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(C)Cc1ccoc1C |
| InChI | InChI=1S/C12H18N2O4/c1-4-17-11(15)7-13-12(16)14(3)8-10-5-6-18-9(10)2/h5-6H,4,7-8H2,1-3H3,(H,13,16) |
| InChIKey | FZXZWBZJRHWKLY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |