C11H11BrClFN2O2S — CID 103077507
3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide (PubChem CID 103077507) has the molecular formula C11H11BrClFN2O2S and a molecular weight of 369.64 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103077507 |
| Molecular Formula | C11H11BrClFN2O2S |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide |
| SMILES | C#CC(C)(C)NS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C11H11BrClFN2O2S/c1-4-11(2,3)16-19(17,18)7-5-6(13)8(12)10(15)9(7)14/h1,5,16H,15H2,2-3H3 |
| InChIKey | FJCALWXMAVUXTF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|