C14H12Cl2N2O3S — CID 110618393
N-(5-acetyl-2-methylphenyl)-5,6-dichloropyridine-3-sulfonamide (PubChem CID 110618393) has the molecular formula C14H12Cl2N2O3S and a molecular weight of 359.23 g/mol. Its IUPAC name is N-(5-acetyl-2-methylphenyl)-5,6-dichloropyridine-3-sulfonamide.
| Compound Name | N-(5-acetyl-2-methylphenyl)-5,6-dichloropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110618393 |
| Molecular Formula | C14H12Cl2N2O3S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | N-(5-acetyl-2-methylphenyl)-5,6-dichloropyridine-3-sulfonamide |
| SMILES | CC(=O)c1ccc(C)c(NS(=O)(=O)c2cnc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H12Cl2N2O3S/c1-8-3-4-10(9(2)19)5-13(8)18-22(20,21)11-6-12(15)14(16)17-7-11/h3-7,18H,1-2H3 |
| InChIKey | GOXSFKDYAOSRAW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|