C11H13N5O2S2 — CID 61480808
N-(4-cyclopropyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-3-sulfonamide (PubChem CID 61480808) has the molecular formula C11H13N5O2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61480808 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)Nc2nc(C3CC3)cs2)cn1 |
| InChI | InChI=1S/C11H13N5O2S2/c12-15-10-4-3-8(5-13-10)20(17,18)16-11-14-9(6-19-11)7-1-2-7/h3-7H,1-2,12H2,(H,13,15)(H,14,16) |
| InChIKey | MOCJPGKUYJRFMI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|