C12H10N4O2S2 — CID 115606342
6-cyano-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide (PubChem CID 115606342) has the molecular formula C12H10N4O2S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 6-cyano-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115606342 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 6-cyano-N-(4-cyclopropyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2nc(C3CC3)cs2)cn1 |
| InChI | InChI=1S/C12H10N4O2S2/c13-5-9-3-4-10(6-14-9)20(17,18)16-12-15-11(7-19-12)8-1-2-8/h3-4,6-8H,1-2H2,(H,15,16) |
| InChIKey | SOMSNSLAOXFJAP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |