C12H16N4O2S2 — CID 62142703
2-(propylamino)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide (PubChem CID 62142703) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-(propylamino)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-(propylamino)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62142703 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(propylamino)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)NCc2cccs2)cn1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-2-5-13-12-14-8-11(9-15-12)20(17,18)16-7-10-4-3-6-19-10/h3-4,6,8-9,16H,2,5,7H2,1H3,(H,13,14,15) |
| InChIKey | ZQMXSNMDIPHLNQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |