C9H11N3O2S2 — CID 71998246
1-ethyl-N-thiophen-3-ylpyrazole-4-sulfonamide (PubChem CID 71998246) has the molecular formula C9H11N3O2S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-ethyl-N-thiophen-3-ylpyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-thiophen-3-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 71998246 |
| Molecular Formula | C9H11N3O2S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 1-ethyl-N-thiophen-3-ylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2ccsc2)cn1 |
| InChI | InChI=1S/C9H11N3O2S2/c1-2-12-6-9(5-10-12)16(13,14)11-8-3-4-15-7-8/h3-7,11H,2H2,1H3 |
| InChIKey | YRJCJHVFLNNOEH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |