C12H15N3O3S2 — CID 71978362
N-(1-ethylpyrazol-4-yl)sulfonyl-3-thiophen-3-ylpropanamide (PubChem CID 71978362) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)sulfonyl-3-thiophen-3-ylpropanamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)sulfonyl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 71978362 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)sulfonyl-3-thiophen-3-ylpropanamide |
| SMILES | CCn1cc(S(=O)(=O)NC(=O)CCc2ccsc2)cn1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-2-15-8-11(7-13-15)20(17,18)14-12(16)4-3-10-5-6-19-9-10/h5-9H,2-4H2,1H3,(H,14,16) |
| InChIKey | PSLGYQCJVBGIBB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |