C13H12FNO3S2 — CID 71987649
N-(3-fluorophenyl)sulfonyl-3-thiophen-3-ylpropanamide (PubChem CID 71987649) has the molecular formula C13H12FNO3S2 and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)sulfonyl-3-thiophen-3-ylpropanamide.
| Compound Name | N-(3-fluorophenyl)sulfonyl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 71987649 |
| Molecular Formula | C13H12FNO3S2 |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-(3-fluorophenyl)sulfonyl-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CCc1ccsc1)NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H12FNO3S2/c14-11-2-1-3-12(8-11)20(17,18)15-13(16)5-4-10-6-7-19-9-10/h1-3,6-9H,4-5H2,(H,15,16) |
| InChIKey | OHLRGCKGFJLFLA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |