C18H15FN2O2S2 — CID 30505197
5-(4-fluorophenyl)-N'-(3-thiophen-3-ylpropanoyl)thiophene-2-carbohydrazide (PubChem CID 30505197) has the molecular formula C18H15FN2O2S2 and a molecular weight of 374.46 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N'-(3-thiophen-3-ylpropanoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-(4-fluorophenyl)-N'-(3-thiophen-3-ylpropanoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 30505197 |
| Molecular Formula | C18H15FN2O2S2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 5-(4-fluorophenyl)-N'-(3-thiophen-3-ylpropanoyl)thiophene-2-carbohydrazide |
| SMILES | O=C(CCc1ccsc1)NNC(=O)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H15FN2O2S2/c19-14-4-2-13(3-5-14)15-6-7-16(25-15)18(23)21-20-17(22)8-1-12-9-10-24-11-12/h2-7,9-11H,1,8H2,(H,20,22)(H,21,23) |
| InChIKey | APJWAIRFBNHFEM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|