C16H17FN2O2S — CID 9140377
5-(4-fluorophenyl)-N'-(3-methylbutanoyl)thiophene-2-carbohydrazide (PubChem CID 9140377) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N'-(3-methylbutanoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-(4-fluorophenyl)-N'-(3-methylbutanoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9140377 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-(4-fluorophenyl)-N'-(3-methylbutanoyl)thiophene-2-carbohydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H17FN2O2S/c1-10(2)9-15(20)18-19-16(21)14-8-7-13(22-14)11-3-5-12(17)6-4-11/h3-8,10H,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | AAXNYCRHRZSJQZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|